C19H26FN3O2 — CID 23850180
N-[2-[(4-fluorophenyl)methylcarbamoylamino]cyclohexyl]-3-methylbut-2-enamide (PubChem CID 23850180) has the molecular formula C19H26FN3O2 and a molecular weight of 347.43 g/mol. Its IUPAC name is N-[2-[(4-fluorophenyl)methylcarbamoylamino]cyclohexyl]-3-methylbut-2-enamide.
| Compound Name | N-[2-[(4-fluorophenyl)methylcarbamoylamino]cyclohexyl]-3-methylbut-2-enamide |
|---|---|
| PubChem CID | 23850180 |
| Molecular Formula | C19H26FN3O2 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | N-[2-[(4-fluorophenyl)methylcarbamoylamino]cyclohexyl]-3-methylbut-2-enamide |
| SMILES | CC(C)=CC(=O)NC1CCCCC1NC(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H26FN3O2/c1-13(2)11-18(24)22-16-5-3-4-6-17(16)23-19(25)21-12-14-7-9-15(20)10-8-14/h7-11,16-17H,3-6,12H2,1-2H3,(H,22,24)(H2,21,23,25) |
| InChIKey | JOPYUMOGXNXSJC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|