C20H29N3O2 — CID 23850327
3-methyl-N-[2-(2-phenylethylcarbamoylamino)cyclohexyl]but-2-enamide (PubChem CID 23850327) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is 3-methyl-N-[2-(2-phenylethylcarbamoylamino)cyclohexyl]but-2-enamide.
| Compound Name | 3-methyl-N-[2-(2-phenylethylcarbamoylamino)cyclohexyl]but-2-enamide |
|---|---|
| PubChem CID | 23850327 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 3-methyl-N-[2-(2-phenylethylcarbamoylamino)cyclohexyl]but-2-enamide |
| SMILES | CC(C)=CC(=O)NC1CCCCC1NC(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C20H29N3O2/c1-15(2)14-19(24)22-17-10-6-7-11-18(17)23-20(25)21-13-12-16-8-4-3-5-9-16/h3-5,8-9,14,17-18H,6-7,10-13H2,1-2H3,(H,22,24)(H2,21,23,25) |
| InChIKey | PZMSCEHBSIBIFA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|