C19H26N2O — CID 124739142
1-(2-phenylethyl)-3-[(1R,2R,6S,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]urea (PubChem CID 124739142) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is 1-(2-phenylethyl)-3-[(1R,2R,6S,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]urea.
| Compound Name | 1-(2-phenylethyl)-3-[(1R,2R,6S,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]urea |
|---|---|
| PubChem CID | 124739142 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 1-(2-phenylethyl)-3-[(1R,2R,6S,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]urea |
| SMILES | O=C(NCCc1ccccc1)N[C@@H]1C[C@H]2C[C@H]1[C@H]1CCC[C@H]21 |
| InChI | InChI=1S/C19H26N2O/c22-19(20-10-9-13-5-2-1-3-6-13)21-18-12-14-11-17(18)16-8-4-7-15(14)16/h1-3,5-6,14-18H,4,7-12H2,(H2,20,21,22)/t14-,15-,16+,17+,18-/m1/s1 |
| InChIKey | SCMHESUUMBRFNW-DFBDCSAJSA-N |
| XLogP | 3.35 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |