C17H20BrNO — CID 43066709
2-bromo-N-(8-tricyclo[5.2.1.02,6]decanyl)benzamide (PubChem CID 43066709) has the molecular formula C17H20BrNO and a molecular weight of 334.26 g/mol. Its IUPAC name is 2-bromo-N-(8-tricyclo[5.2.1.02,6]decanyl)benzamide.
| Compound Name | 2-bromo-N-(8-tricyclo[5.2.1.02,6]decanyl)benzamide |
|---|---|
| PubChem CID | 43066709 |
| Molecular Formula | C17H20BrNO |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 2-bromo-N-(8-tricyclo[5.2.1.02,6]decanyl)benzamide |
| SMILES | O=C(NC1CC2CC1C1CCCC21)c1ccccc1Br |
| InChI | InChI=1S/C17H20BrNO/c18-15-7-2-1-4-13(15)17(20)19-16-9-10-8-14(16)12-6-3-5-11(10)12/h1-2,4,7,10-12,14,16H,3,5-6,8-9H2,(H,19,20) |
| InChIKey | AYWKANKYAPZYKU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |