C18H22BrNO — CID 107982436
2-bromo-3-methyl-N-(8-tricyclo[5.2.1.02,6]decanyl)benzamide (PubChem CID 107982436) has the molecular formula C18H22BrNO and a molecular weight of 348.28 g/mol. Its IUPAC name is 2-bromo-3-methyl-N-(8-tricyclo[5.2.1.02,6]decanyl)benzamide.
| Compound Name | 2-bromo-3-methyl-N-(8-tricyclo[5.2.1.02,6]decanyl)benzamide |
|---|---|
| PubChem CID | 107982436 |
| Molecular Formula | C18H22BrNO |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 2-bromo-3-methyl-N-(8-tricyclo[5.2.1.02,6]decanyl)benzamide |
| SMILES | Cc1cccc(C(=O)NC2CC3CC2C2CCCC32)c1Br |
| InChI | InChI=1S/C18H22BrNO/c1-10-4-2-7-14(17(10)19)18(21)20-16-9-11-8-15(16)13-6-3-5-12(11)13/h2,4,7,11-13,15-16H,3,5-6,8-9H2,1H3,(H,20,21) |
| InChIKey | JENKMCGPQSOURM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |