C14H18BrNOS — CID 103855203
2-bromo-3-methyl-N-(2-methylsulfanylcyclopentyl)benzamide (PubChem CID 103855203) has the molecular formula C14H18BrNOS and a molecular weight of 328.28 g/mol. Its IUPAC name is 2-bromo-3-methyl-N-(2-methylsulfanylcyclopentyl)benzamide.
| Compound Name | 2-bromo-3-methyl-N-(2-methylsulfanylcyclopentyl)benzamide |
|---|---|
| PubChem CID | 103855203 |
| Molecular Formula | C14H18BrNOS |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 2-bromo-3-methyl-N-(2-methylsulfanylcyclopentyl)benzamide |
| SMILES | CSC1CCCC1NC(=O)c1cccc(C)c1Br |
| InChI | InChI=1S/C14H18BrNOS/c1-9-5-3-6-10(13(9)15)14(17)16-11-7-4-8-12(11)18-2/h3,5-6,11-12H,4,7-8H2,1-2H3,(H,16,17) |
| InChIKey | WDDYSJUODUCYFG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |