C22H26N2O2 — CID 979091
2-methyl-N-[(1S,2S)-2-[(2-methylbenzoyl)amino]cyclohexyl]benzamide (PubChem CID 979091) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is 2-methyl-N-[(1S,2S)-2-[(2-methylbenzoyl)amino]cyclohexyl]benzamide.
| Compound Name | 2-methyl-N-[(1S,2S)-2-[(2-methylbenzoyl)amino]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 979091 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 2-methyl-N-[(1S,2S)-2-[(2-methylbenzoyl)amino]cyclohexyl]benzamide |
| SMILES | Cc1ccccc1C(=O)N[C@H]1CCCC[C@@H]1NC(=O)c1ccccc1C |
| InChI | InChI=1S/C22H26N2O2/c1-15-9-3-5-11-17(15)21(25)23-19-13-7-8-14-20(19)24-22(26)18-12-6-4-10-16(18)2/h3-6,9-12,19-20H,7-8,13-14H2,1-2H3,(H,23,25)(H,24,26)/t19-,20-/m0/s1 |
| InChIKey | QTIFJJFTXBEGFX-PMACEKPBSA-N |
| XLogP | 3.77 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |