C20H20I2N2O6 — CID 132919153
2-iodyl-N-[(1S,2S)-2-[(2-iodylbenzoyl)amino]cyclohexyl]benzamide (PubChem CID 132919153) has the molecular formula C20H20I2N2O6 and a molecular weight of 638.20 g/mol. Its IUPAC name is 2-iodyl-N-[(1S,2S)-2-[(2-iodylbenzoyl)amino]cyclohexyl]benzamide.
| Compound Name | 2-iodyl-N-[(1S,2S)-2-[(2-iodylbenzoyl)amino]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 132919153 |
| Molecular Formula | C20H20I2N2O6 |
| Molecular Weight | 638.20 g/mol |
| Exact Mass | 637.94 |
| IUPAC Name | 2-iodyl-N-[(1S,2S)-2-[(2-iodylbenzoyl)amino]cyclohexyl]benzamide |
| SMILES | O=C(N[C@H]1CCCC[C@@H]1NC(=O)c1ccccc1I(=O)=O)c1ccccc1I(=O)=O |
| InChI | InChI=1S/C20H20I2N2O6/c25-19(13-7-1-3-9-15(13)21(27)28)23-17-11-5-6-12-18(17)24-20(26)14-8-2-4-10-16(14)22(29)30/h1-4,7-10,17-18H,5-6,11-12H2,(H,23,25)(H,24,26)/t17-,18-/m0/s1 |
| InChIKey | SJBQMTRJVQMMFI-ROUUACIJSA-N |
| XLogP | 3.89 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.20 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|