C13H16INO2 — CID 6709814
N-[(2R)-2-hydroxycyclohexyl]-2-iodobenzamide (PubChem CID 6709814) has the molecular formula C13H16INO2 and a molecular weight of 345.18 g/mol. Its IUPAC name is N-[(2R)-2-hydroxycyclohexyl]-2-iodobenzamide.
| Compound Name | N-[(2R)-2-hydroxycyclohexyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 6709814 |
| Molecular Formula | C13H16INO2 |
| Molecular Weight | 345.18 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | N-[(2R)-2-hydroxycyclohexyl]-2-iodobenzamide |
| SMILES | O=C(NC1CCCC[C@H]1O)c1ccccc1I |
| InChI | InChI=1S/C13H16INO2/c14-10-6-2-1-5-9(10)13(17)15-11-7-3-4-8-12(11)16/h1-2,5-6,11-12,16H,3-4,7-8H2,(H,15,17)/t11?,12-/m1/s1 |
| InChIKey | JJFNATFZKTZFDF-PIJUOVFKSA-N |
| XLogP | 2.32 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.18 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|