C13H16IN3O2 — CID 76978483
N-[2-(N'-hydroxycarbamimidoyl)cyclopentyl]-2-iodobenzamide (PubChem CID 76978483) has the molecular formula C13H16IN3O2 and a molecular weight of 373.19 g/mol. Its IUPAC name is N-[2-(N'-hydroxycarbamimidoyl)cyclopentyl]-2-iodobenzamide.
| Compound Name | N-[2-(N'-hydroxycarbamimidoyl)cyclopentyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 76978483 |
| Molecular Formula | C13H16IN3O2 |
| Molecular Weight | 373.19 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | N-[2-(N'-hydroxycarbamimidoyl)cyclopentyl]-2-iodobenzamide |
| SMILES | NC(=NO)C1CCCC1NC(=O)c1ccccc1I |
| InChI | InChI=1S/C13H16IN3O2/c14-10-6-2-1-4-8(10)13(18)16-11-7-3-5-9(11)12(15)17-19/h1-2,4,6,9,11,19H,3,5,7H2,(H2,15,17)(H,16,18) |
| InChIKey | BGBQMPZYWMEDFC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.19 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|