C14H15F3INO — CID 60722477
2-iodo-N-[2-(trifluoromethyl)cyclohexyl]benzamide (PubChem CID 60722477) has the molecular formula C14H15F3INO and a molecular weight of 397.18 g/mol. Its IUPAC name is 2-iodo-N-[2-(trifluoromethyl)cyclohexyl]benzamide.
| Compound Name | 2-iodo-N-[2-(trifluoromethyl)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 60722477 |
| Molecular Formula | C14H15F3INO |
| Molecular Weight | 397.18 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | 2-iodo-N-[2-(trifluoromethyl)cyclohexyl]benzamide |
| SMILES | O=C(NC1CCCCC1C(F)(F)F)c1ccccc1I |
| InChI | InChI=1S/C14H15F3INO/c15-14(16,17)10-6-2-4-8-12(10)19-13(20)9-5-1-3-7-11(9)18/h1,3,5,7,10,12H,2,4,6,8H2,(H,19,20) |
| InChIKey | RXZKXIACRQAISV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.18 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|