C18H15F3INO — CID 152994869
2-iodo-N-[(1S)-2-[2-(trifluoromethyl)phenyl]cyclobutyl]benzamide (PubChem CID 152994869) has the molecular formula C18H15F3INO and a molecular weight of 445.22 g/mol. Its IUPAC name is 2-iodo-N-[(1S)-2-[2-(trifluoromethyl)phenyl]cyclobutyl]benzamide.
| Compound Name | 2-iodo-N-[(1S)-2-[2-(trifluoromethyl)phenyl]cyclobutyl]benzamide |
|---|---|
| PubChem CID | 152994869 |
| Molecular Formula | C18H15F3INO |
| Molecular Weight | 445.22 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | 2-iodo-N-[(1S)-2-[2-(trifluoromethyl)phenyl]cyclobutyl]benzamide |
| SMILES | O=C(N[C@H]1CCC1c1ccccc1C(F)(F)F)c1ccccc1I |
| InChI | InChI=1S/C18H15F3INO/c19-18(20,21)14-7-3-1-5-11(14)12-9-10-16(12)23-17(24)13-6-2-4-8-15(13)22/h1-8,12,16H,9-10H2,(H,23,24)/t12?,16-/m0/s1 |
| InChIKey | UWZWGHUTIOSAIU-INSVYWFGSA-N |
| XLogP | 4.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.22 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|