C17H22F3NO — CID 75399293
N-[2-[2-(trifluoromethyl)phenyl]cycloheptyl]propanamide (PubChem CID 75399293) has the molecular formula C17H22F3NO and a molecular weight of 313.36 g/mol. Its IUPAC name is N-[2-[2-(trifluoromethyl)phenyl]cycloheptyl]propanamide.
| Compound Name | N-[2-[2-(trifluoromethyl)phenyl]cycloheptyl]propanamide |
|---|---|
| PubChem CID | 75399293 |
| Molecular Formula | C17H22F3NO |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | N-[2-[2-(trifluoromethyl)phenyl]cycloheptyl]propanamide |
| SMILES | CCC(=O)NC1CCCCCC1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H22F3NO/c1-2-16(22)21-15-11-5-3-4-9-13(15)12-8-6-7-10-14(12)17(18,19)20/h6-8,10,13,15H,2-5,9,11H2,1H3,(H,21,22) |
| InChIKey | KNUNPKHXOAALJS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |