C16H17F3N4O — CID 75397270
2-(triazol-1-yl)-N-[2-[2-(trifluoromethyl)phenyl]cyclopentyl]acetamide (PubChem CID 75397270) has the molecular formula C16H17F3N4O and a molecular weight of 338.33 g/mol. Its IUPAC name is 2-(triazol-1-yl)-N-[2-[2-(trifluoromethyl)phenyl]cyclopentyl]acetamide.
| Compound Name | 2-(triazol-1-yl)-N-[2-[2-(trifluoromethyl)phenyl]cyclopentyl]acetamide |
|---|---|
| PubChem CID | 75397270 |
| Molecular Formula | C16H17F3N4O |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 2-(triazol-1-yl)-N-[2-[2-(trifluoromethyl)phenyl]cyclopentyl]acetamide |
| SMILES | O=C(Cn1ccnn1)NC1CCCC1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H17F3N4O/c17-16(18,19)13-6-2-1-4-11(13)12-5-3-7-14(12)21-15(24)10-23-9-8-20-22-23/h1-2,4,6,8-9,12,14H,3,5,7,10H2,(H,21,24) |
| InChIKey | JLYQYIQFZIAUDT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |