C20H26F3NO3 — CID 102554068
4-hydroxy-N-[2-[2-(trifluoromethyl)phenyl]cycloheptyl]oxane-4-carboxamide (PubChem CID 102554068) has the molecular formula C20H26F3NO3 and a molecular weight of 385.43 g/mol. Its IUPAC name is 4-hydroxy-N-[2-[2-(trifluoromethyl)phenyl]cycloheptyl]oxane-4-carboxamide.
| Compound Name | 4-hydroxy-N-[2-[2-(trifluoromethyl)phenyl]cycloheptyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 102554068 |
| Molecular Formula | C20H26F3NO3 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 4-hydroxy-N-[2-[2-(trifluoromethyl)phenyl]cycloheptyl]oxane-4-carboxamide |
| SMILES | O=C(NC1CCCCCC1c1ccccc1C(F)(F)F)C1(O)CCOCC1 |
| InChI | InChI=1S/C20H26F3NO3/c21-20(22,23)16-8-5-4-6-14(16)15-7-2-1-3-9-17(15)24-18(25)19(26)10-12-27-13-11-19/h4-6,8,15,17,26H,1-3,7,9-13H2,(H,24,25) |
| InChIKey | VISLRNMGMLZZSU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |