C17H22F3NO — CID 141014652
4-[(1S,2R)-2-[2-(trifluoromethyl)phenyl]cyclohexyl]morpholine (PubChem CID 141014652) has the molecular formula C17H22F3NO and a molecular weight of 313.36 g/mol. Its IUPAC name is 4-[(1S,2R)-2-[2-(trifluoromethyl)phenyl]cyclohexyl]morpholine.
| Compound Name | 4-[(1S,2R)-2-[2-(trifluoromethyl)phenyl]cyclohexyl]morpholine |
|---|---|
| PubChem CID | 141014652 |
| Molecular Formula | C17H22F3NO |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 4-[(1S,2R)-2-[2-(trifluoromethyl)phenyl]cyclohexyl]morpholine |
| SMILES | FC(F)(F)c1ccccc1[C@H]1CCCC[C@@H]1N1CCOCC1 |
| InChI | InChI=1S/C17H22F3NO/c18-17(19,20)15-7-3-1-5-13(15)14-6-2-4-8-16(14)21-9-11-22-12-10-21/h1,3,5,7,14,16H,2,4,6,8-12H2/t14-,16+/m1/s1 |
| InChIKey | MFLWIAGWAXOGNG-ZBFHGGJFSA-N |
| XLogP | 4.06 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |