About 1,2-bis(trifluoromethyl)benzene;oxolane
1,2-bis(trifluoromethyl)benzene;oxolane (PubChem CID 158991746) has the molecular formula C12H12F6O
and a molecular weight of 286.21 g/mol. Its IUPAC name is 1,2-bis(trifluoromethyl)benzene;oxolane.
Molecular Properties
| Compound Name | 1,2-bis(trifluoromethyl)benzene;oxolane |
| PubChem CID | 158991746 |
| Molecular Formula | C12H12F6O |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 1,2-bis(trifluoromethyl)benzene;oxolane |
| SMILES | C1CCOC1.FC(F)(F)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C8H4F6.C4H8O/c9-7(10,11)5-3-1-2-4-6(5)8(12,13)14;1-2-4-5-3-1/h1-4H;1-4H2 |
| InChIKey | JQFZWVBTKZNJAX-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,2-bis(trifluoromethyl)benzene;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(trifluoromethyl)benzene;oxolane?
The IUPAC name of 1,2-bis(trifluoromethyl)benzene;oxolane (CID 158991746) is 1,2-bis(trifluoromethyl)benzene;oxolane.
What is the SMILES notation for 1,2-bis(trifluoromethyl)benzene;oxolane?
The canonical SMILES for 1,2-bis(trifluoromethyl)benzene;oxolane is C1CCOC1.FC(F)(F)c1ccccc1C(F)(F)F.
What is the InChIKey of 1,2-bis(trifluoromethyl)benzene;oxolane?
The InChIKey is JQFZWVBTKZNJAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4F6.C4H8O/c9-7(10,11)5-3-1-2-4-6(5)8(12,13)14;1-2-4-5-3-1/h1-4H;1-4H2.
What are the key properties of 1,2-bis(trifluoromethyl)benzene;oxolane?
1,2-bis(trifluoromethyl)benzene;oxolane has a molecular weight of 286.21 g/mol, XLogP of 4.52, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(trifluoromethyl)benzene;oxolane is sourced from PubChem (CID 158991746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).