C12H12F6O — CID 158991746
1,2-bis(trifluoromethyl)benzene;oxolane (PubChem CID 158991746) has the molecular formula C12H12F6O and a molecular weight of 286.21 g/mol. Its IUPAC name is 1,2-bis(trifluoromethyl)benzene;oxolane.
| Compound Name | 1,2-bis(trifluoromethyl)benzene;oxolane |
|---|---|
| PubChem CID | 158991746 |
| Molecular Formula | C12H12F6O |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 1,2-bis(trifluoromethyl)benzene;oxolane |
| SMILES | C1CCOC1.FC(F)(F)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C8H4F6.C4H8O/c9-7(10,11)5-3-1-2-4-6(5)8(12,13)14;1-2-4-5-3-1/h1-4H;1-4H2 |
| InChIKey | JQFZWVBTKZNJAX-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |