About benzoic acid;oxane
benzoic acid;oxane (PubChem CID 158907979) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is benzoic acid;oxane.
Molecular Properties
| Compound Name | benzoic acid;oxane |
| PubChem CID | 158907979 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | benzoic acid;oxane |
| SMILES | C1CCOCC1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C7H6O2.C5H10O/c8-7(9)6-4-2-1-3-5-6;1-2-4-6-5-3-1/h1-5H,(H,8,9);1-5H2 |
| InChIKey | JGHAVGVRTINBTM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzoic acid;oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;oxane?
The IUPAC name of benzoic acid;oxane (CID 158907979) is benzoic acid;oxane.
What is the SMILES notation for benzoic acid;oxane?
The canonical SMILES for benzoic acid;oxane is C1CCOCC1.O=C(O)c1ccccc1.
What is the InChIKey of benzoic acid;oxane?
The InChIKey is JGHAVGVRTINBTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.C5H10O/c8-7(9)6-4-2-1-3-5-6;1-2-4-6-5-3-1/h1-5H,(H,8,9);1-5H2.
What are the key properties of benzoic acid;oxane?
benzoic acid;oxane has a molecular weight of 208.26 g/mol, XLogP of 2.57, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;oxane is sourced from PubChem (CID 158907979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).