About CID 11129167
CID 11129167 (PubChem CID 11129167) has the molecular formula C16H17NaO2+
and a molecular weight of 264.30 g/mol.
Molecular Properties
| Compound Name | CID 11129167 |
| PubChem CID | 11129167 |
| Molecular Formula | C16H17NaO2+ |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | — |
| SMILES | C1CCOC1.O=C([C]1[CH][CH][CH][CH]1)c1ccccc1.[Na+] |
| InChI | InChI=1S/C12H9O.C4H8O.Na/c13-12(11-8-4-5-9-11)10-6-2-1-3-7-10;1-2-4-5-3-1;/h1-9H;1-4H2;/q;;+1 |
| InChIKey | NJWAMGVJIKQRIA-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 11129167 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11129167?
The IUPAC name of CID 11129167 (CID 11129167) is not available.
What is the SMILES notation for CID 11129167?
The canonical SMILES for CID 11129167 is C1CCOC1.O=C([C]1[CH][CH][CH][CH]1)c1ccccc1.[Na+].
What is the InChIKey of CID 11129167?
The InChIKey is NJWAMGVJIKQRIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9O.C4H8O.Na/c13-12(11-8-4-5-9-11)10-6-2-1-3-7-10;1-2-4-5-3-1;/h1-9H;1-4H2;/q;;+1.
What are the key properties of CID 11129167?
CID 11129167 has a molecular weight of 264.30 g/mol, XLogP of 0.08, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11129167 is sourced from PubChem (CID 11129167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).