About ethane;1-fluoroethenylbenzene;oxolane
ethane;1-fluoroethenylbenzene;oxolane (PubChem CID 91220828) has the molecular formula C14H21FO
and a molecular weight of 224.32 g/mol. Its IUPAC name is ethane;1-fluoroethenylbenzene;oxolane.
Molecular Properties
| Compound Name | ethane;1-fluoroethenylbenzene;oxolane |
| PubChem CID | 91220828 |
| Molecular Formula | C14H21FO |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | ethane;1-fluoroethenylbenzene;oxolane |
| SMILES | C1CCOC1.C=C(F)c1ccccc1.CC |
| InChI | InChI=1S/C8H7F.C4H8O.C2H6/c1-7(9)8-5-3-2-4-6-8;1-2-4-5-3-1;1-2/h2-6H,1H2;1-4H2;1-2H3 |
| InChIKey | WHDWRYAMNQQURV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;1-fluoroethenylbenzene;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-fluoroethenylbenzene;oxolane?
The IUPAC name of ethane;1-fluoroethenylbenzene;oxolane (CID 91220828) is ethane;1-fluoroethenylbenzene;oxolane.
What is the SMILES notation for ethane;1-fluoroethenylbenzene;oxolane?
The canonical SMILES for ethane;1-fluoroethenylbenzene;oxolane is C1CCOC1.C=C(F)c1ccccc1.CC.
What is the InChIKey of ethane;1-fluoroethenylbenzene;oxolane?
The InChIKey is WHDWRYAMNQQURV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F.C4H8O.C2H6/c1-7(9)8-5-3-2-4-6-8;1-2-4-5-3-1;1-2/h2-6H,1H2;1-4H2;1-2H3.
What are the key properties of ethane;1-fluoroethenylbenzene;oxolane?
ethane;1-fluoroethenylbenzene;oxolane has a molecular weight of 224.32 g/mol, XLogP of 4.45, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-fluoroethenylbenzene;oxolane is sourced from PubChem (CID 91220828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).