C46H44O5 — CID 161173543
1-methoxy-4-[(E)-2-(4-methoxyphenyl)-1,2-diphenylethenyl]benzene;(4-methoxyphenyl)-phenylmethanone;oxolane (PubChem CID 161173543) has the molecular formula C46H44O5 and a molecular weight of 676.85 g/mol. Its IUPAC name is 1-methoxy-4-[(E)-2-(4-methoxyphenyl)-1,2-diphenylethenyl]benzene;(4-methoxyphenyl)-phenylmethanone;oxolane.
| Compound Name | 1-methoxy-4-[(E)-2-(4-methoxyphenyl)-1,2-diphenylethenyl]benzene;(4-methoxyphenyl)-phenylmethanone;oxolane |
|---|---|
| PubChem CID | 161173543 |
| Molecular Formula | C46H44O5 |
| Molecular Weight | 676.85 g/mol |
| Exact Mass | 676.32 |
| IUPAC Name | 1-methoxy-4-[(E)-2-(4-methoxyphenyl)-1,2-diphenylethenyl]benzene;(4-methoxyphenyl)-phenylmethanone;oxolane |
| SMILES | C1CCOC1.COc1ccc(/C(=C(\c2ccccc2)c2ccc(OC)cc2)c2ccccc2)cc1.COc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H24O2.C14H12O2.C4H8O/c1-29-25-17-13-23(14-18-25)27(21-9-5-3-6-10-21)28(22-11-7-4-8-12-22)24-15-19-26(30-2)20-16-24;1-16-13-9-7-12(8-10-13)14(15)11-5-3-2-4-6-11;1-2-4-5-3-1/h3-20H,1-2H3;2-10H,1H3;1-4H2/b28-27+;; |
| InChIKey | URMSVTUEUMDNFA-JZYARHMISA-N |
| XLogP | 10.43 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.85 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|