C13H18O4 — CID 67598100
2-(4-methoxyphenyl)acetic acid;oxolane (PubChem CID 67598100) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)acetic acid;oxolane.
| Compound Name | 2-(4-methoxyphenyl)acetic acid;oxolane |
|---|---|
| PubChem CID | 67598100 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 2-(4-methoxyphenyl)acetic acid;oxolane |
| SMILES | C1CCOC1.COc1ccc(CC(=O)O)cc1 |
| InChI | InChI=1S/C9H10O3.C4H8O/c1-12-8-4-2-7(3-5-8)6-9(10)11;1-2-4-5-3-1/h2-5H,6H2,1H3,(H,10,11);1-4H2 |
| InChIKey | WLCNNPMKAZSMBR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |