C20H26Cl2N2O3 — CID 139735158
2-[4-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]phenyl]acetic acid;dihydrochloride (PubChem CID 139735158) has the molecular formula C20H26Cl2N2O3 and a molecular weight of 413.35 g/mol. Its IUPAC name is 2-[4-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]phenyl]acetic acid;dihydrochloride.
| Compound Name | 2-[4-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]phenyl]acetic acid;dihydrochloride |
|---|---|
| PubChem CID | 139735158 |
| Molecular Formula | C20H26Cl2N2O3 |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 2-[4-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]phenyl]acetic acid;dihydrochloride |
| SMILES | COc1ccc(N2CCN(Cc3ccc(CC(=O)O)cc3)CC2)cc1.Cl.Cl |
| InChI | InChI=1S/C20H24N2O3.2ClH/c1-25-19-8-6-18(7-9-19)22-12-10-21(11-13-22)15-17-4-2-16(3-5-17)14-20(23)24;;/h2-9H,10-15H2,1H3,(H,23,24);2*1H |
| InChIKey | CMCNYPSODRSTGS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|