C24H32N4O4S — CID 43922370
[4-(4-methoxyphenyl)piperazin-1-yl]-[4-[(4-methylsulfonylpiperazin-1-yl)methyl]phenyl]methanone (PubChem CID 43922370) has the molecular formula C24H32N4O4S and a molecular weight of 472.61 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)piperazin-1-yl]-[4-[(4-methylsulfonylpiperazin-1-yl)methyl]phenyl]methanone.
| Compound Name | [4-(4-methoxyphenyl)piperazin-1-yl]-[4-[(4-methylsulfonylpiperazin-1-yl)methyl]phenyl]methanone |
|---|---|
| PubChem CID | 43922370 |
| Molecular Formula | C24H32N4O4S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | [4-(4-methoxyphenyl)piperazin-1-yl]-[4-[(4-methylsulfonylpiperazin-1-yl)methyl]phenyl]methanone |
| SMILES | COc1ccc(N2CCN(C(=O)c3ccc(CN4CCN(S(C)(=O)=O)CC4)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H32N4O4S/c1-32-23-9-7-22(8-10-23)26-13-15-27(16-14-26)24(29)21-5-3-20(4-6-21)19-25-11-17-28(18-12-25)33(2,30)31/h3-10H,11-19H2,1-2H3 |
| InChIKey | QUGDMJNNJXJYJN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 73.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|