C22H23BrN4O2 — CID 35323460
[4-[(4-bromopyrazol-1-yl)methyl]phenyl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 35323460) has the molecular formula C22H23BrN4O2 and a molecular weight of 455.36 g/mol. Its IUPAC name is [4-[(4-bromopyrazol-1-yl)methyl]phenyl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [4-[(4-bromopyrazol-1-yl)methyl]phenyl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 35323460 |
| Molecular Formula | C22H23BrN4O2 |
| Molecular Weight | 455.36 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | [4-[(4-bromopyrazol-1-yl)methyl]phenyl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(N2CCN(C(=O)c3ccc(Cn4cc(Br)cn4)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H23BrN4O2/c1-29-21-8-6-20(7-9-21)25-10-12-26(13-11-25)22(28)18-4-2-17(3-5-18)15-27-16-19(23)14-24-27/h2-9,14,16H,10-13,15H2,1H3 |
| InChIKey | RZSDOKGCYWCGEG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|