C19H17BrN4O2S — CID 3555189
4-[(4-bromopyrazol-1-yl)methyl]-N-[(4-methoxyphenyl)carbamothioyl]benzamide (PubChem CID 3555189) has the molecular formula C19H17BrN4O2S and a molecular weight of 445.34 g/mol. Its IUPAC name is 4-[(4-bromopyrazol-1-yl)methyl]-N-[(4-methoxyphenyl)carbamothioyl]benzamide.
| Compound Name | 4-[(4-bromopyrazol-1-yl)methyl]-N-[(4-methoxyphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3555189 |
| Molecular Formula | C19H17BrN4O2S |
| Molecular Weight | 445.34 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | 4-[(4-bromopyrazol-1-yl)methyl]-N-[(4-methoxyphenyl)carbamothioyl]benzamide |
| SMILES | COc1ccc(NC(=S)NC(=O)c2ccc(Cn3cc(Br)cn3)cc2)cc1 |
| InChI | InChI=1S/C19H17BrN4O2S/c1-26-17-8-6-16(7-9-17)22-19(27)23-18(25)14-4-2-13(3-5-14)11-24-12-15(20)10-21-24/h2-10,12H,11H2,1H3,(H2,22,23,25,27) |
| InChIKey | WWEJMBMDGGGUMZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.34 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|