C18H20N2O3S — CID 2283977
N-[(4-methoxyphenyl)carbamothioyl]-4-propoxybenzamide (PubChem CID 2283977) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)carbamothioyl]-4-propoxybenzamide.
| Compound Name | N-[(4-methoxyphenyl)carbamothioyl]-4-propoxybenzamide |
|---|---|
| PubChem CID | 2283977 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | N-[(4-methoxyphenyl)carbamothioyl]-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)NC(=S)Nc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C18H20N2O3S/c1-3-12-23-16-8-4-13(5-9-16)17(21)20-18(24)19-14-6-10-15(22-2)11-7-14/h4-11H,3,12H2,1-2H3,(H2,19,20,21,24) |
| InChIKey | MBUBSOGRMUKDCK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|