C17H19N3O4S2 — CID 4938795
4-propoxy-N-[(4-sulfamoylphenyl)carbamothioyl]benzamide (PubChem CID 4938795) has the molecular formula C17H19N3O4S2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 4-propoxy-N-[(4-sulfamoylphenyl)carbamothioyl]benzamide.
| Compound Name | 4-propoxy-N-[(4-sulfamoylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4938795 |
| Molecular Formula | C17H19N3O4S2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 4-propoxy-N-[(4-sulfamoylphenyl)carbamothioyl]benzamide |
| SMILES | CCCOc1ccc(C(=O)NC(=S)Nc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C17H19N3O4S2/c1-2-11-24-14-7-3-12(4-8-14)16(21)20-17(25)19-13-5-9-15(10-6-13)26(18,22)23/h3-10H,2,11H2,1H3,(H2,18,22,23)(H2,19,20,21,25) |
| InChIKey | RWPQIGCEXVIMTK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|