C21H20BrClN4O — CID 95754507
[4-[(4-bromopyrazol-1-yl)methyl]phenyl]-[4-(4-chlorophenyl)piperazin-1-yl]methanone (PubChem CID 95754507) has the molecular formula C21H20BrClN4O and a molecular weight of 459.78 g/mol. Its IUPAC name is [4-[(4-bromopyrazol-1-yl)methyl]phenyl]-[4-(4-chlorophenyl)piperazin-1-yl]methanone.
| Compound Name | [4-[(4-bromopyrazol-1-yl)methyl]phenyl]-[4-(4-chlorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 95754507 |
| Molecular Formula | C21H20BrClN4O |
| Molecular Weight | 459.78 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | [4-[(4-bromopyrazol-1-yl)methyl]phenyl]-[4-(4-chlorophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(Cn2cc(Br)cn2)cc1)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H20BrClN4O/c22-18-13-24-27(15-18)14-16-1-3-17(4-2-16)21(28)26-11-9-25(10-12-26)20-7-5-19(23)6-8-20/h1-8,13,15H,9-12,14H2 |
| InChIKey | RPSSYNZSZOFYMB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.78 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |