C22H23BrN4O — CID 19290845
(4-benzylpiperazin-1-yl)-[3-[(4-bromopyrazol-1-yl)methyl]phenyl]methanone (PubChem CID 19290845) has the molecular formula C22H23BrN4O and a molecular weight of 439.36 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-[3-[(4-bromopyrazol-1-yl)methyl]phenyl]methanone.
| Compound Name | (4-benzylpiperazin-1-yl)-[3-[(4-bromopyrazol-1-yl)methyl]phenyl]methanone |
|---|---|
| PubChem CID | 19290845 |
| Molecular Formula | C22H23BrN4O |
| Molecular Weight | 439.36 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-[3-[(4-bromopyrazol-1-yl)methyl]phenyl]methanone |
| SMILES | O=C(c1cccc(Cn2cc(Br)cn2)c1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H23BrN4O/c23-21-14-24-27(17-21)16-19-7-4-8-20(13-19)22(28)26-11-9-25(10-12-26)15-18-5-2-1-3-6-18/h1-8,13-14,17H,9-12,15-16H2 |
| InChIKey | SHDOBTVKHKUXHJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |