C18H18BrClN2O — CID 19325535
(3-bromophenyl)-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methanone (PubChem CID 19325535) has the molecular formula C18H18BrClN2O and a molecular weight of 393.71 g/mol. Its IUPAC name is (3-bromophenyl)-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methanone.
| Compound Name | (3-bromophenyl)-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 19325535 |
| Molecular Formula | C18H18BrClN2O |
| Molecular Weight | 393.71 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | (3-bromophenyl)-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1cccc(Br)c1)N1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C18H18BrClN2O/c19-16-3-1-2-15(12-16)18(23)22-10-8-21(9-11-22)13-14-4-6-17(20)7-5-14/h1-7,12H,8-11,13H2 |
| InChIKey | HRLCEIIBTXGREG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.71 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |