C19H18BrF3N2O — CID 19329650
(3-bromophenyl)-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]methanone (PubChem CID 19329650) has the molecular formula C19H18BrF3N2O and a molecular weight of 427.26 g/mol. Its IUPAC name is (3-bromophenyl)-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]methanone.
| Compound Name | (3-bromophenyl)-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 19329650 |
| Molecular Formula | C19H18BrF3N2O |
| Molecular Weight | 427.26 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | (3-bromophenyl)-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1cccc(Br)c1)N1CCN(Cc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H18BrF3N2O/c20-17-6-2-4-15(12-17)18(26)25-9-7-24(8-10-25)13-14-3-1-5-16(11-14)19(21,22)23/h1-6,11-12H,7-10,13H2 |
| InChIKey | HHQOXAZDKYFKRA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.26 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |