C16H17ClN4O — CID 136573282
[4-(6-amino-3-pyridinyl)piperazin-1-yl]-(4-chlorophenyl)methanone (PubChem CID 136573282) has the molecular formula C16H17ClN4O and a molecular weight of 316.79 g/mol. Its IUPAC name is [4-(6-amino-3-pyridinyl)piperazin-1-yl]-(4-chlorophenyl)methanone.
| Compound Name | [4-(6-amino-3-pyridinyl)piperazin-1-yl]-(4-chlorophenyl)methanone |
|---|---|
| PubChem CID | 136573282 |
| Molecular Formula | C16H17ClN4O |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | [4-(6-amino-3-pyridinyl)piperazin-1-yl]-(4-chlorophenyl)methanone |
| SMILES | Nc1ccc(N2CCN(C(=O)c3ccc(Cl)cc3)CC2)cn1 |
| InChI | InChI=1S/C16H17ClN4O/c17-13-3-1-12(2-4-13)16(22)21-9-7-20(8-10-21)14-5-6-15(18)19-11-14/h1-6,11H,7-10H2,(H2,18,19) |
| InChIKey | ZQVCFAQSLQTPEM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |