C14H15BrN4O2 — CID 43461882
[4-(6-amino-3-pyridinyl)piperazin-1-yl]-(5-bromofuran-2-yl)methanone (PubChem CID 43461882) has the molecular formula C14H15BrN4O2 and a molecular weight of 351.20 g/mol. Its IUPAC name is [4-(6-amino-3-pyridinyl)piperazin-1-yl]-(5-bromofuran-2-yl)methanone.
| Compound Name | [4-(6-amino-3-pyridinyl)piperazin-1-yl]-(5-bromofuran-2-yl)methanone |
|---|---|
| PubChem CID | 43461882 |
| Molecular Formula | C14H15BrN4O2 |
| Molecular Weight | 351.20 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | [4-(6-amino-3-pyridinyl)piperazin-1-yl]-(5-bromofuran-2-yl)methanone |
| SMILES | Nc1ccc(N2CCN(C(=O)c3ccc(Br)o3)CC2)cn1 |
| InChI | InChI=1S/C14H15BrN4O2/c15-12-3-2-11(21-12)14(20)19-7-5-18(6-8-19)10-1-4-13(16)17-9-10/h1-4,9H,5-8H2,(H2,16,17) |
| InChIKey | FZFUIARZCTUHDQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.20 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |