C24H29N3O5 — CID 135126765
dimethyl 2-[[4-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]anilino]methylidene]propanedioate (PubChem CID 135126765) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is dimethyl 2-[[4-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]anilino]methylidene]propanedioate.
| Compound Name | dimethyl 2-[[4-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]anilino]methylidene]propanedioate |
|---|---|
| PubChem CID | 135126765 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | dimethyl 2-[[4-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]anilino]methylidene]propanedioate |
| SMILES | COC(=O)C(=CNc1ccc(CN2CCN(c3ccc(OC)cc3)CC2)cc1)C(=O)OC |
| InChI | InChI=1S/C24H29N3O5/c1-30-21-10-8-20(9-11-21)27-14-12-26(13-15-27)17-18-4-6-19(7-5-18)25-16-22(23(28)31-2)24(29)32-3/h4-11,16,25H,12-15,17H2,1-3H3 |
| InChIKey | MLIBDQUUESRHAP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|