C19H23ClN2O — CID 55830862
1-[(4-chlorophenyl)methyl]-4-(4-methoxyphenyl)-1,4-diazepane (PubChem CID 55830862) has the molecular formula C19H23ClN2O and a molecular weight of 330.86 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-4-(4-methoxyphenyl)-1,4-diazepane.
| Compound Name | 1-[(4-chlorophenyl)methyl]-4-(4-methoxyphenyl)-1,4-diazepane |
|---|---|
| PubChem CID | 55830862 |
| Molecular Formula | C19H23ClN2O |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-4-(4-methoxyphenyl)-1,4-diazepane |
| SMILES | COc1ccc(N2CCCN(Cc3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C19H23ClN2O/c1-23-19-9-7-18(8-10-19)22-12-2-11-21(13-14-22)15-16-3-5-17(20)6-4-16/h3-10H,2,11-15H2,1H3 |
| InChIKey | KQUYQTKZGUWPIW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|