C18H20F2N2 — CID 87015648
1-(4-fluorophenyl)-4-[(4-fluorophenyl)methyl]-1,4-diazepane (PubChem CID 87015648) has the molecular formula C18H20F2N2 and a molecular weight of 302.37 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-[(4-fluorophenyl)methyl]-1,4-diazepane.
| Compound Name | 1-(4-fluorophenyl)-4-[(4-fluorophenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 87015648 |
| Molecular Formula | C18H20F2N2 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 1-(4-fluorophenyl)-4-[(4-fluorophenyl)methyl]-1,4-diazepane |
| SMILES | Fc1ccc(CN2CCCN(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C18H20F2N2/c19-16-4-2-15(3-5-16)14-21-10-1-11-22(13-12-21)18-8-6-17(20)7-9-18/h2-9H,1,10-14H2 |
| InChIKey | YXTMSXHNLSCWAK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |