C19H24FN3O — CID 77092564
1-[(6-ethoxy-3-pyridinyl)methyl]-4-(4-fluorophenyl)-1,4-diazepane (PubChem CID 77092564) has the molecular formula C19H24FN3O and a molecular weight of 329.42 g/mol. Its IUPAC name is 1-[(6-ethoxy-3-pyridinyl)methyl]-4-(4-fluorophenyl)-1,4-diazepane.
| Compound Name | 1-[(6-ethoxy-3-pyridinyl)methyl]-4-(4-fluorophenyl)-1,4-diazepane |
|---|---|
| PubChem CID | 77092564 |
| Molecular Formula | C19H24FN3O |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 1-[(6-ethoxy-3-pyridinyl)methyl]-4-(4-fluorophenyl)-1,4-diazepane |
| SMILES | CCOc1ccc(CN2CCCN(c3ccc(F)cc3)CC2)cn1 |
| InChI | InChI=1S/C19H24FN3O/c1-2-24-19-9-4-16(14-21-19)15-22-10-3-11-23(13-12-22)18-7-5-17(20)6-8-18/h4-9,14H,2-3,10-13,15H2,1H3 |
| InChIKey | JFFAQNFHJWZHFU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |