C31H41N3O3 — CID 66887441
1,4,7-tris[(4-methoxyphenyl)methyl]-1,4,7-triazecane (PubChem CID 66887441) has the molecular formula C31H41N3O3 and a molecular weight of 503.69 g/mol. Its IUPAC name is 1,4,7-tris[(4-methoxyphenyl)methyl]-1,4,7-triazecane.
| Compound Name | 1,4,7-tris[(4-methoxyphenyl)methyl]-1,4,7-triazecane |
|---|---|
| PubChem CID | 66887441 |
| Molecular Formula | C31H41N3O3 |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.31 |
| IUPAC Name | 1,4,7-tris[(4-methoxyphenyl)methyl]-1,4,7-triazecane |
| SMILES | COc1ccc(CN2CCCN(Cc3ccc(OC)cc3)CCN(Cc3ccc(OC)cc3)CC2)cc1 |
| InChI | InChI=1S/C31H41N3O3/c1-35-29-11-5-26(6-12-29)23-32-17-4-18-33(24-27-7-13-30(36-2)14-8-27)20-22-34(21-19-32)25-28-9-15-31(37-3)16-10-28/h5-16H,4,17-25H2,1-3H3 |
| InChIKey | ASBDKLQTNQDULN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |