C21H21N5O — CID 168541647
2-[[4-[4-(4-methoxyphenyl)piperazin-1-yl]anilino]methylidene]propanedinitrile (PubChem CID 168541647) has the molecular formula C21H21N5O and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-[[4-[4-(4-methoxyphenyl)piperazin-1-yl]anilino]methylidene]propanedinitrile.
| Compound Name | 2-[[4-[4-(4-methoxyphenyl)piperazin-1-yl]anilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168541647 |
| Molecular Formula | C21H21N5O |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 2-[[4-[4-(4-methoxyphenyl)piperazin-1-yl]anilino]methylidene]propanedinitrile |
| SMILES | COc1ccc(N2CCN(c3ccc(NC=C(C#N)C#N)cc3)CC2)cc1 |
| InChI | InChI=1S/C21H21N5O/c1-27-21-8-6-20(7-9-21)26-12-10-25(11-13-26)19-4-2-18(3-5-19)24-16-17(14-22)15-23/h2-9,16,24H,10-13H2,1H3 |
| InChIKey | DPXQFYZDBYNZCK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 75.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|