C16H16N4O2 — CID 168544756
1-[4-(2,2-dicyanoethenylamino)phenyl]piperidine-4-carboxylic acid (PubChem CID 168544756) has the molecular formula C16H16N4O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is 1-[4-(2,2-dicyanoethenylamino)phenyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[4-(2,2-dicyanoethenylamino)phenyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 168544756 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 1-[4-(2,2-dicyanoethenylamino)phenyl]piperidine-4-carboxylic acid |
| SMILES | N#CC(C#N)=CNc1ccc(N2CCC(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C16H16N4O2/c17-9-12(10-18)11-19-14-1-3-15(4-2-14)20-7-5-13(6-8-20)16(21)22/h1-4,11,13,19H,5-8H2,(H,21,22) |
| InChIKey | XZZLRRGTMOKUGL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|