C11H7N3O2 — CID 168511874
4-(2,2-dicyanoethenylamino)benzoic acid (PubChem CID 168511874) has the molecular formula C11H7N3O2 and a molecular weight of 213.20 g/mol. Its IUPAC name is 4-(2,2-dicyanoethenylamino)benzoic acid.
| Compound Name | 4-(2,2-dicyanoethenylamino)benzoic acid |
|---|---|
| PubChem CID | 168511874 |
| Molecular Formula | C11H7N3O2 |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | 4-(2,2-dicyanoethenylamino)benzoic acid |
| SMILES | N#CC(C#N)=CNc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C11H7N3O2/c12-5-8(6-13)7-14-10-3-1-9(2-4-10)11(15)16/h1-4,7,14H,(H,15,16) |
| InChIKey | IVXKDWZHPRFMSI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|