C17H20N4O — CID 17196267
4-(2,2-dicyanoethenylamino)-N,N-dipropylbenzamide (PubChem CID 17196267) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is 4-(2,2-dicyanoethenylamino)-N,N-dipropylbenzamide.
| Compound Name | 4-(2,2-dicyanoethenylamino)-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 17196267 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 4-(2,2-dicyanoethenylamino)-N,N-dipropylbenzamide |
| SMILES | CCCN(CCC)C(=O)c1ccc(NC=C(C#N)C#N)cc1 |
| InChI | InChI=1S/C17H20N4O/c1-3-9-21(10-4-2)17(22)15-5-7-16(8-6-15)20-13-14(11-18)12-19/h5-8,13,20H,3-4,9-10H2,1-2H3 |
| InChIKey | WKOUCRZHYWVAMX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 79.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|