C11H7N3O3 — CID 168511873
5-(2,2-dicyanoethenylamino)-2-hydroxybenzoic acid (PubChem CID 168511873) has the molecular formula C11H7N3O3 and a molecular weight of 229.20 g/mol. Its IUPAC name is 5-(2,2-dicyanoethenylamino)-2-hydroxybenzoic acid.
| Compound Name | 5-(2,2-dicyanoethenylamino)-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 168511873 |
| Molecular Formula | C11H7N3O3 |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 5-(2,2-dicyanoethenylamino)-2-hydroxybenzoic acid |
| SMILES | N#CC(C#N)=CNc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H7N3O3/c12-4-7(5-13)6-14-8-1-2-10(15)9(3-8)11(16)17/h1-3,6,14-15H,(H,16,17) |
| InChIKey | HIDAYVDKYUPLGC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 117.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|