C9H8N2O3 — CID 45089274
5-(cyanomethylamino)-2-hydroxybenzoic acid (PubChem CID 45089274) has the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. Its IUPAC name is 5-(cyanomethylamino)-2-hydroxybenzoic acid.
| Compound Name | 5-(cyanomethylamino)-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 45089274 |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 5-(cyanomethylamino)-2-hydroxybenzoic acid |
| SMILES | N#CCNc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C9H8N2O3/c10-3-4-11-6-1-2-8(12)7(5-6)9(13)14/h1-2,5,11-12H,4H2,(H,13,14) |
| InChIKey | YHUUWDVXDBJAMH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|