C14H14F2NO3P3 — CID 142891106
5-[[3,4-difluoro-2,5,6-tris(phosphanyl)phenyl]methylamino]-2-hydroxybenzoic acid (PubChem CID 142891106) has the molecular formula C14H14F2NO3P3 and a molecular weight of 375.19 g/mol. Its IUPAC name is 5-[[3,4-difluoro-2,5,6-tris(phosphanyl)phenyl]methylamino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[3,4-difluoro-2,5,6-tris(phosphanyl)phenyl]methylamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 142891106 |
| Molecular Formula | C14H14F2NO3P3 |
| Molecular Weight | 375.19 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | 5-[[3,4-difluoro-2,5,6-tris(phosphanyl)phenyl]methylamino]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(NCc2c(P)c(F)c(F)c(P)c2P)ccc1O |
| InChI | InChI=1S/C14H14F2NO3P3/c15-9-10(16)13(23)12(22)7(11(9)21)4-17-5-1-2-8(18)6(3-5)14(19)20/h1-3,17-18H,4,21-23H2,(H,19,20) |
| InChIKey | UBFLXCBFAPANKS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.19 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|