C30H27ClF2N2O6 — CID 175364280
5-[2-(4-chlorophenyl)ethylamino]-2-hydroxybenzoic acid;5-[2-(3,4-difluorophenyl)ethylamino]-2-hydroxybenzoic acid (PubChem CID 175364280) has the molecular formula C30H27ClF2N2O6 and a molecular weight of 585.00 g/mol. Its IUPAC name is 5-[2-(4-chlorophenyl)ethylamino]-2-hydroxybenzoic acid;5-[2-(3,4-difluorophenyl)ethylamino]-2-hydroxybenzoic acid.
| Compound Name | 5-[2-(4-chlorophenyl)ethylamino]-2-hydroxybenzoic acid;5-[2-(3,4-difluorophenyl)ethylamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 175364280 |
| Molecular Formula | C30H27ClF2N2O6 |
| Molecular Weight | 585.00 g/mol |
| Exact Mass | 584.15 |
| IUPAC Name | 5-[2-(4-chlorophenyl)ethylamino]-2-hydroxybenzoic acid;5-[2-(3,4-difluorophenyl)ethylamino]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(NCCc2ccc(Cl)cc2)ccc1O.O=C(O)c1cc(NCCc2ccc(F)c(F)c2)ccc1O |
| InChI | InChI=1S/C15H14ClNO3.C15H13F2NO3/c16-11-3-1-10(2-4-11)7-8-17-12-5-6-14(18)13(9-12)15(19)20;16-12-3-1-9(7-13(12)17)5-6-18-10-2-4-14(19)11(8-10)15(20)21/h1-6,9,17-18H,7-8H2,(H,19,20);1-4,7-8,18-19H,5-6H2,(H,20,21) |
| InChIKey | WXSAUJFFUKOBPT-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.00 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|