C14H11ClFNO3 — CID 107685555
2-chloro-5-[(3-fluoro-4-hydroxyphenyl)methylamino]benzoic acid (PubChem CID 107685555) has the molecular formula C14H11ClFNO3 and a molecular weight of 295.70 g/mol. Its IUPAC name is 2-chloro-5-[(3-fluoro-4-hydroxyphenyl)methylamino]benzoic acid.
| Compound Name | 2-chloro-5-[(3-fluoro-4-hydroxyphenyl)methylamino]benzoic acid |
|---|---|
| PubChem CID | 107685555 |
| Molecular Formula | C14H11ClFNO3 |
| Molecular Weight | 295.70 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 2-chloro-5-[(3-fluoro-4-hydroxyphenyl)methylamino]benzoic acid |
| SMILES | O=C(O)c1cc(NCc2ccc(O)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C14H11ClFNO3/c15-11-3-2-9(6-10(11)14(19)20)17-7-8-1-4-13(18)12(16)5-8/h1-6,17-18H,7H2,(H,19,20) |
| InChIKey | KPLGHMXZDBTJNM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.70 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |