C14H10BrCl2NO2 — CID 83230245
5-[(3-bromo-4-chlorophenyl)methylamino]-2-chlorobenzoic acid (PubChem CID 83230245) has the molecular formula C14H10BrCl2NO2 and a molecular weight of 375.05 g/mol. Its IUPAC name is 5-[(3-bromo-4-chlorophenyl)methylamino]-2-chlorobenzoic acid.
| Compound Name | 5-[(3-bromo-4-chlorophenyl)methylamino]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 83230245 |
| Molecular Formula | C14H10BrCl2NO2 |
| Molecular Weight | 375.05 g/mol |
| Exact Mass | 372.93 |
| IUPAC Name | 5-[(3-bromo-4-chlorophenyl)methylamino]-2-chlorobenzoic acid |
| SMILES | O=C(O)c1cc(NCc2ccc(Cl)c(Br)c2)ccc1Cl |
| InChI | InChI=1S/C14H10BrCl2NO2/c15-11-5-8(1-3-13(11)17)7-18-9-2-4-12(16)10(6-9)14(19)20/h1-6,18H,7H2,(H,19,20) |
| InChIKey | RVUZTGVZXVBTMT-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.05 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |