C14H12ClNO5 — CID 107730669
2-chloro-5-[(2,3,4-trihydroxyphenyl)methylamino]benzoic acid (PubChem CID 107730669) has the molecular formula C14H12ClNO5 and a molecular weight of 309.71 g/mol. Its IUPAC name is 2-chloro-5-[(2,3,4-trihydroxyphenyl)methylamino]benzoic acid.
| Compound Name | 2-chloro-5-[(2,3,4-trihydroxyphenyl)methylamino]benzoic acid |
|---|---|
| PubChem CID | 107730669 |
| Molecular Formula | C14H12ClNO5 |
| Molecular Weight | 309.71 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 2-chloro-5-[(2,3,4-trihydroxyphenyl)methylamino]benzoic acid |
| SMILES | O=C(O)c1cc(NCc2ccc(O)c(O)c2O)ccc1Cl |
| InChI | InChI=1S/C14H12ClNO5/c15-10-3-2-8(5-9(10)14(20)21)16-6-7-1-4-11(17)13(19)12(7)18/h1-5,16-19H,6H2,(H,20,21) |
| InChIKey | OIBAZSNZSXDNOR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.71 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|